C26H31N3O2 — CID 44536296
N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide (PubChem CID 44536296) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 44536296 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide |
| SMILES | CCCNCc1ccc(-c2ccc(CN(CCOC)C(=O)c3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C26H31N3O2/c1-3-15-27-18-22-11-14-25(28-19-22)23-12-9-21(10-13-23)20-29(16-17-31-2)26(30)24-7-5-4-6-8-24/h4-14,19,27H,3,15-18,20H2,1-2H3 |
| InChIKey | YIKSANUKZIVQDP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|