C17H24F3N3O4 — CID 47050197
tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]carbamate (PubChem CID 47050197) has the molecular formula C17H24F3N3O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]carbamate.
| Compound Name | tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 47050197 |
| Molecular Formula | C17H24F3N3O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl N-(pyridin-3-ylmethyl)-N-[3-(2,2,2-trifluoroethoxycarbonylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNC(=O)OCC(F)(F)F)Cc1cccnc1 |
| InChI | InChI=1S/C17H24F3N3O4/c1-16(2,3)27-15(25)23(11-13-6-4-7-21-10-13)9-5-8-22-14(24)26-12-17(18,19)20/h4,6-7,10H,5,8-9,11-12H2,1-3H3,(H,22,24) |
| InChIKey | HLEYCTISBKNULC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|