C20H33F3IN5O2 — CID 109474940
tert-butyl N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide (PubChem CID 109474940) has the molecular formula C20H33F3IN5O2 and a molecular weight of 559.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide |
|---|---|
| PubChem CID | 109474940 |
| Molecular Formula | C20H33F3IN5O2 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCN(Cc1cccnc1)C(=O)OC(C)(C)C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C20H32F3N5O2.HI/c1-5-25-17(27-12-9-20(21,22)23)26-11-7-13-28(18(29)30-19(2,3)4)15-16-8-6-10-24-14-16;/h6,8,10,14H,5,7,9,11-13,15H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | XXNBGOUOKWPQEB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|