C22H37N5O2 — CID 110991765
tert-butyl N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 110991765) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is tert-butyl N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 110991765 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | tert-butyl N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | CCN/C(=N\CCCN(Cc1cccnc1)C(=O)OC(C)(C)C)NC1CCCC1 |
| InChI | InChI=1S/C22H37N5O2/c1-5-24-20(26-19-11-6-7-12-19)25-14-9-15-27(21(28)29-22(2,3)4)17-18-10-8-13-23-16-18/h8,10,13,16,19H,5-7,9,11-12,14-15,17H2,1-4H3,(H2,24,25,26) |
| InChIKey | QYUUGSAKDSXXSU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|