C22H34IN5O3 — CID 110938373
tert-butyl N-[3-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide (PubChem CID 110938373) has the molecular formula C22H34IN5O3 and a molecular weight of 543.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide |
|---|---|
| PubChem CID | 110938373 |
| Molecular Formula | C22H34IN5O3 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-(furan-2-ylmethyl)carbamimidoyl]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCCN(Cc1cccnc1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C22H33N5O3.HI/c1-5-24-20(26-16-19-10-7-14-29-19)25-12-8-13-27(21(28)30-22(2,3)4)17-18-9-6-11-23-15-18;/h6-7,9-11,14-15H,5,8,12-13,16-17H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | GWUXAZSMABXTIR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|