C21H31N5O2S — CID 111066213
tert-butyl N-[3-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 111066213) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 111066213 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | tert-butyl N-[3-[[amino-(2-thiophen-2-ylethylamino)methylidene]amino]propyl]-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC/N=C(\N)NCCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C21H31N5O2S/c1-21(2,3)28-20(27)26(16-17-7-4-10-23-15-17)13-6-11-24-19(22)25-12-9-18-8-5-14-29-18/h4-5,7-8,10,14-15H,6,9,11-13,16H2,1-3H3,(H3,22,24,25) |
| InChIKey | VQCNRSIGZVYYON-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|