C17H22BrClFNO2 — CID 167530141
tert-butyl N-[(4-bromo-3-chloro-2-fluorophenyl)methyl]-N-cyclopentylcarbamate (PubChem CID 167530141) has the molecular formula C17H22BrClFNO2 and a molecular weight of 406.72 g/mol. Its IUPAC name is tert-butyl N-[(4-bromo-3-chloro-2-fluorophenyl)methyl]-N-cyclopentylcarbamate.
| Compound Name | tert-butyl N-[(4-bromo-3-chloro-2-fluorophenyl)methyl]-N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 167530141 |
| Molecular Formula | C17H22BrClFNO2 |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | tert-butyl N-[(4-bromo-3-chloro-2-fluorophenyl)methyl]-N-cyclopentylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(Br)c(Cl)c1F)C1CCCC1 |
| InChI | InChI=1S/C17H22BrClFNO2/c1-17(2,3)23-16(22)21(12-6-4-5-7-12)10-11-8-9-13(18)14(19)15(11)20/h8-9,12H,4-7,10H2,1-3H3 |
| InChIKey | AGFZPJORNXFWSA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|