C18H25ClN5O3+ — CID 140737533
tert-butyl N-[4-[(6-chloro-3-nitroso-2H-pyrazolo[4,3-c]pyridin-1-ium-1-yl)methyl]cyclohexyl]carbamate (PubChem CID 140737533) has the molecular formula C18H25ClN5O3+ and a molecular weight of 394.88 g/mol. Its IUPAC name is tert-butyl N-[4-[(6-chloro-3-nitroso-2H-pyrazolo[4,3-c]pyridin-1-ium-1-yl)methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(6-chloro-3-nitroso-2H-pyrazolo[4,3-c]pyridin-1-ium-1-yl)methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 140737533 |
| Molecular Formula | C18H25ClN5O3+ |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | tert-butyl N-[4-[(6-chloro-3-nitroso-2H-pyrazolo[4,3-c]pyridin-1-ium-1-yl)methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C[n+]2[nH]c(N=O)c3cnc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H24ClN5O3/c1-18(2,3)27-17(25)21-12-6-4-11(5-7-12)10-24-14-8-15(19)20-9-13(14)16(22-24)23-26/h8-9,11-12H,4-7,10H2,1-3H3,(H,21,25)/p+1 |
| InChIKey | HVPLJDWMHWGMKI-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|