C17H30N2O3Si — CID 140896602
tert-butyl N-[4-(5-trimethylsilyl-1,2-oxazol-3-yl)cyclohexyl]carbamate (PubChem CID 140896602) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is tert-butyl N-[4-(5-trimethylsilyl-1,2-oxazol-3-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(5-trimethylsilyl-1,2-oxazol-3-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 140896602 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | tert-butyl N-[4-(5-trimethylsilyl-1,2-oxazol-3-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(c2cc([Si](C)(C)C)on2)CC1 |
| InChI | InChI=1S/C17H30N2O3Si/c1-17(2,3)21-16(20)18-13-9-7-12(8-10-13)14-11-15(22-19-14)23(4,5)6/h11-13H,7-10H2,1-6H3,(H,18,20) |
| InChIKey | DYMDCMOPOPHCON-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|