C21H34N4O3 — CID 55869656
tert-butyl N-[1-(1-tert-butyl-3-cyclopropylpyrazole-5-carbonyl)piperidin-4-yl]carbamate (PubChem CID 55869656) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is tert-butyl N-[1-(1-tert-butyl-3-cyclopropylpyrazole-5-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(1-tert-butyl-3-cyclopropylpyrazole-5-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55869656 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | tert-butyl N-[1-(1-tert-butyl-3-cyclopropylpyrazole-5-carbonyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)c2cc(C3CC3)nn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34N4O3/c1-20(2,3)25-17(13-16(23-25)14-7-8-14)18(26)24-11-9-15(10-12-24)22-19(27)28-21(4,5)6/h13-15H,7-12H2,1-6H3,(H,22,27) |
| InChIKey | DRWNIYFGFFFZTF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |