C17H26N4O3 — CID 155282262
tert-butyl N-[1-(6-amino-2-methylpyridine-3-carbonyl)piperidin-4-yl]carbamate (PubChem CID 155282262) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl N-[1-(6-amino-2-methylpyridine-3-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-amino-2-methylpyridine-3-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 155282262 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl N-[1-(6-amino-2-methylpyridine-3-carbonyl)piperidin-4-yl]carbamate |
| SMILES | Cc1nc(N)ccc1C(=O)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-11-13(5-6-14(18)19-11)15(22)21-9-7-12(8-10-21)20-16(23)24-17(2,3)4/h5-6,12H,7-10H2,1-4H3,(H2,18,19)(H,20,23) |
| InChIKey | RICOVMHVALWLFR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |