About propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate
propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate (PubChem CID 164879494) has the molecular formula C19H29N5O2S
and a molecular weight of 391.54 g/mol. Its IUPAC name is propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate |
| PubChem CID | 164879494 |
| Molecular Formula | C19H29N5O2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate |
| SMILES | CC(C)OC(=O)NC1CCC(c2cc(Nc3ccsn3)nn2C(C)(C)C)C1 |
| InChI | InChI=1S/C19H29N5O2S/c1-12(2)26-18(25)20-14-7-6-13(10-14)15-11-17(21-16-8-9-27-23-16)22-24(15)19(3,4)5/h8-9,11-14H,6-7,10H2,1-5H3,(H,20,25)(H,21,22,23) |
| InChIKey | DWMJOJOTOAAJSR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate?
The IUPAC name of propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate (CID 164879494) is propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate.
What is the SMILES notation for propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate?
The canonical SMILES for propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate is CC(C)OC(=O)NC1CCC(c2cc(Nc3ccsn3)nn2C(C)(C)C)C1.
What is the InChIKey of propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate?
The InChIKey is DWMJOJOTOAAJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N5O2S/c1-12(2)26-18(25)20-14-7-6-13(10-14)15-11-17(21-16-8-9-27-23-16)22-24(15)19(3,4)5/h8-9,11-14H,6-7,10H2,1-5H3,(H,20,25)(H,21,22,23).
What are the key properties of propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate?
propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate has a molecular weight of 391.54 g/mol, XLogP of 4.61, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[3-[1-tert-butyl-3-(1,2-thiazol-3-ylamino)pyrazol-5-yl]cyclopentyl]carbamate is sourced from PubChem (CID 164879494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).