C20H27N3O3 — CID 164880400
benzyl N-[1-tert-butyl-5-[(1S,3S)-3-hydroxycyclopentyl]pyrazol-3-yl]carbamate (PubChem CID 164880400) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is benzyl N-[1-tert-butyl-5-[(1S,3S)-3-hydroxycyclopentyl]pyrazol-3-yl]carbamate.
| Compound Name | benzyl N-[1-tert-butyl-5-[(1S,3S)-3-hydroxycyclopentyl]pyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 164880400 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | benzyl N-[1-tert-butyl-5-[(1S,3S)-3-hydroxycyclopentyl]pyrazol-3-yl]carbamate |
| SMILES | CC(C)(C)n1nc(NC(=O)OCc2ccccc2)cc1[C@H]1CC[C@H](O)C1 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)23-17(15-9-10-16(24)11-15)12-18(22-23)21-19(25)26-13-14-7-5-4-6-8-14/h4-8,12,15-16,24H,9-11,13H2,1-3H3,(H,21,22,25)/t15-,16-/m0/s1 |
| InChIKey | GRLDKEOCBZFGED-HOTGVXAUSA-N |
| XLogP | 4.02 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |