C21H29N3O5S — CID 170451325
[3-[1-tert-butyl-5-(phenylmethoxycarbonylamino)pyrazol-3-yl]cyclopentyl] methanesulfonate (PubChem CID 170451325) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is [3-[1-tert-butyl-5-(phenylmethoxycarbonylamino)pyrazol-3-yl]cyclopentyl] methanesulfonate.
| Compound Name | [3-[1-tert-butyl-5-(phenylmethoxycarbonylamino)pyrazol-3-yl]cyclopentyl] methanesulfonate |
|---|---|
| PubChem CID | 170451325 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [3-[1-tert-butyl-5-(phenylmethoxycarbonylamino)pyrazol-3-yl]cyclopentyl] methanesulfonate |
| SMILES | CC(C)(C)n1nc(C2CCC(OS(C)(=O)=O)C2)cc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-21(2,3)24-19(22-20(25)28-14-15-8-6-5-7-9-15)13-18(23-24)16-10-11-17(12-16)29-30(4,26)27/h5-9,13,16-17H,10-12,14H2,1-4H3,(H,22,25) |
| InChIKey | YDLYPLBCCCCXBY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|