C43H48N3O5Si — CID 176998152
CID 176998152 (PubChem CID 176998152) has the molecular formula C43H48N3O5Si and a molecular weight of 714.96 g/mol.
| Compound Name | CID 176998152 |
|---|---|
| PubChem CID | 176998152 |
| Molecular Formula | C43H48N3O5Si |
| Molecular Weight | 714.96 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc([Si](OC2CC(c3cc(NC(=O)COc4cccc(OCc5ccccc5)c4C=O)n(C(C)(C)C)n3)C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H48N3O5Si/c1-42(2,3)32-20-22-35(23-21-32)52(34-16-11-8-12-17-34)51-33-24-31(25-33)37-26-40(46(45-37)43(4,5)6)44-41(48)29-50-39-19-13-18-38(36(39)27-47)49-28-30-14-9-7-10-15-30/h7-23,26-27,31,33H,24-25,28-29H2,1-6H3,(H,44,48) |
| InChIKey | OPCPZWDSCQLBFE-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|