C25H33N5O4 — CID 164880088
benzyl N-[1-tert-butyl-3-[(1R,3R)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)cyclopentyl]pyrazol-5-yl]carbamate (PubChem CID 164880088) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is benzyl N-[1-tert-butyl-3-[(1R,3R)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)cyclopentyl]pyrazol-5-yl]carbamate.
| Compound Name | benzyl N-[1-tert-butyl-3-[(1R,3R)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)cyclopentyl]pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 164880088 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | benzyl N-[1-tert-butyl-3-[(1R,3R)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)cyclopentyl]pyrazol-5-yl]carbamate |
| SMILES | CC1(C)NC(=O)N([C@@H]2CC[C@@H](c3cc(NC(=O)OCc4ccccc4)n(C(C)(C)C)n3)C2)C1=O |
| InChI | InChI=1S/C25H33N5O4/c1-24(2,3)30-20(26-23(33)34-15-16-9-7-6-8-10-16)14-19(28-30)17-11-12-18(13-17)29-21(31)25(4,5)27-22(29)32/h6-10,14,17-18H,11-13,15H2,1-5H3,(H,26,33)(H,27,32)/t17-,18-/m1/s1 |
| InChIKey | WBXKKIZFSSQYAG-QZTJIDSGSA-N |
| XLogP | 4.35 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|