C20H27N3O3 — CID 126792887
N-(1-tert-butyl-3-phenylpyrazol-5-yl)-2-(oxolan-3-ylmethoxy)acetamide (PubChem CID 126792887) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(1-tert-butyl-3-phenylpyrazol-5-yl)-2-(oxolan-3-ylmethoxy)acetamide.
| Compound Name | N-(1-tert-butyl-3-phenylpyrazol-5-yl)-2-(oxolan-3-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 126792887 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-(1-tert-butyl-3-phenylpyrazol-5-yl)-2-(oxolan-3-ylmethoxy)acetamide |
| SMILES | CC(C)(C)n1nc(-c2ccccc2)cc1NC(=O)COCC1CCOC1 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)23-18(11-17(22-23)16-7-5-4-6-8-16)21-19(24)14-26-13-15-9-10-25-12-15/h4-8,11,15H,9-10,12-14H2,1-3H3,(H,21,24) |
| InChIKey | SQSMFDDVFVOFKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |