C30H49N5O4Si — CID 167525679
tert-butyl N-[(1S)-1-cycloheptyl-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-2-oxoethyl]carbamate (PubChem CID 167525679) has the molecular formula C30H49N5O4Si and a molecular weight of 571.84 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-cycloheptyl-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-cycloheptyl-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 167525679 |
| Molecular Formula | C30H49N5O4Si |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | tert-butyl N-[(1S)-1-cycloheptyl-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-2-oxoethyl]carbamate |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)OC(C)(C)C)C2CCCCCC2)cn1 |
| InChI | InChI=1S/C30H49N5O4Si/c1-21-26(22(2)35(34-21)20-38-17-18-40(6,7)8)25-16-15-24(19-31-25)32-28(36)27(23-13-11-9-10-12-14-23)33-29(37)39-30(3,4)5/h15-16,19,23,27H,9-14,17-18,20H2,1-8H3,(H,32,36)(H,33,37)/t27-/m0/s1 |
| InChIKey | RHBFCAVKKKQTMW-MHZLTWQESA-N |
| XLogP | 6.68 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|