C30H49N5O4Si — CID 150222099
(2S)-2-cyclohexyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]-2-[[3-hydroxypropyl(methyl)carbamoyl]amino]acetamide (PubChem CID 150222099) has the molecular formula C30H49N5O4Si and a molecular weight of 571.84 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]-2-[[3-hydroxypropyl(methyl)carbamoyl]amino]acetamide.
| Compound Name | (2S)-2-cyclohexyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]-2-[[3-hydroxypropyl(methyl)carbamoyl]amino]acetamide |
|---|---|
| PubChem CID | 150222099 |
| Molecular Formula | C30H49N5O4Si |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | (2S)-2-cyclohexyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]-2-[[3-hydroxypropyl(methyl)carbamoyl]amino]acetamide |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)N(C)CCCO)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H49N5O4Si/c1-22-27(23(2)35(33-22)21-39-19-20-40(4,5)6)24-13-15-26(16-14-24)31-29(37)28(25-11-8-7-9-12-25)32-30(38)34(3)17-10-18-36/h13-16,25,28,36H,7-12,17-21H2,1-6H3,(H,31,37)(H,32,38)/t28-/m0/s1 |
| InChIKey | FTRWVKITVXCDDN-NDEPHWFRSA-N |
| XLogP | 5.39 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|