C26H41N5O4Si — CID 174057842
[(1S)-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-(4-methylcyclohexyl)-2-oxoethyl]carbamic acid (PubChem CID 174057842) has the molecular formula C26H41N5O4Si and a molecular weight of 515.73 g/mol. Its IUPAC name is [(1S)-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-(4-methylcyclohexyl)-2-oxoethyl]carbamic acid.
| Compound Name | [(1S)-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-(4-methylcyclohexyl)-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 174057842 |
| Molecular Formula | C26H41N5O4Si |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | [(1S)-2-[[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-(4-methylcyclohexyl)-2-oxoethyl]carbamic acid |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)O)C2CCC(C)CC2)cn1 |
| InChI | InChI=1S/C26H41N5O4Si/c1-17-7-9-20(10-8-17)24(29-26(33)34)25(32)28-21-11-12-22(27-15-21)23-18(2)30-31(19(23)3)16-35-13-14-36(4,5)6/h11-12,15,17,20,24,29H,7-10,13-14,16H2,1-6H3,(H,28,32)(H,33,34)/t17?,20?,24-/m0/s1 |
| InChIKey | XARDQFHERWNQCY-KGGRFHARSA-N |
| XLogP | 5.28 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|