C44H55N5O3Si — CID 174090381
2-[1-benzyl-4-[(2-methoxyphenyl)methyl]imidazol-2-yl]-3,3-dicyclopropyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]propanamide (PubChem CID 174090381) has the molecular formula C44H55N5O3Si and a molecular weight of 730.04 g/mol. Its IUPAC name is 2-[1-benzyl-4-[(2-methoxyphenyl)methyl]imidazol-2-yl]-3,3-dicyclopropyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]propanamide.
| Compound Name | 2-[1-benzyl-4-[(2-methoxyphenyl)methyl]imidazol-2-yl]-3,3-dicyclopropyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 174090381 |
| Molecular Formula | C44H55N5O3Si |
| Molecular Weight | 730.04 g/mol |
| Exact Mass | 729.41 |
| IUPAC Name | 2-[1-benzyl-4-[(2-methoxyphenyl)methyl]imidazol-2-yl]-3,3-dicyclopropyl-N-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]phenyl]propanamide |
| SMILES | COc1ccccc1Cc1cn(Cc2ccccc2)c(C(C(=O)Nc2ccc(-c3c(C)nn(COCC[Si](C)(C)C)c3C)cc2)C(C2CC2)C2CC2)n1 |
| InChI | InChI=1S/C44H55N5O3Si/c1-30-40(31(2)49(47-30)29-52-24-25-53(4,5)6)33-20-22-37(23-21-33)46-44(50)42(41(34-16-17-34)35-18-19-35)43-45-38(26-36-14-10-11-15-39(36)51-3)28-48(43)27-32-12-8-7-9-13-32/h7-15,20-23,28,34-35,41-42H,16-19,24-27,29H2,1-6H3,(H,46,50) |
| InChIKey | GBSQLQBVKZXLCZ-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.04 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|