C34H44N6O3Si — CID 175146943
N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-2-oxo-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 175146943) has the molecular formula C34H44N6O3Si and a molecular weight of 612.85 g/mol. Its IUPAC name is N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-2-oxo-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-2-oxo-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175146943 |
| Molecular Formula | C34H44N6O3Si |
| Molecular Weight | 612.85 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-2-oxo-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)C(NC(=O)c2ccnn2C)[C@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C34H44N6O3Si/c1-23-31(24(2)40(38-23)22-43-20-21-44(4,5)6)26-14-16-27(17-15-26)36-34(42)32(37-33(41)30-18-19-35-39(30)3)29-13-9-11-25-10-7-8-12-28(25)29/h7-8,10,12,14-19,29,32H,9,11,13,20-22H2,1-6H3,(H,36,42)(H,37,41)/t29-,32?/m0/s1 |
| InChIKey | ZLRPLOALWZAMKM-QGFKTNLFSA-N |
| XLogP | 6.07 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.85 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|