C34H43FN6O3Si — CID 164806391
N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-1-[(1S)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 164806391) has the molecular formula C34H43FN6O3Si and a molecular weight of 630.84 g/mol. Its IUPAC name is N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-1-[(1S)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-1-[(1S)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164806391 |
| Molecular Formula | C34H43FN6O3Si |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | N-[2-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-1-[(1S)-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)C(NC(=O)c2ccnn2C)[C@H]2CCCc3c(F)cccc32)cc1 |
| InChI | InChI=1S/C34H43FN6O3Si/c1-22-31(23(2)41(39-22)21-44-19-20-45(4,5)6)24-13-15-25(16-14-24)37-34(43)32(38-33(42)30-17-18-36-40(30)3)28-11-7-10-27-26(28)9-8-12-29(27)35/h8-9,12-18,28,32H,7,10-11,19-21H2,1-6H3,(H,37,43)(H,38,42)/t28-,32?/m0/s1 |
| InChIKey | XZFHLOZCVBKTAZ-MLAKCTNMSA-N |
| XLogP | 6.21 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|