C25H33N6Na2O6P — CID 175787079
CID 175787079 (PubChem CID 175787079) has the molecular formula C25H33N6Na2O6P and a molecular weight of 590.53 g/mol.
| Compound Name | CID 175787079 |
|---|---|
| PubChem CID | 175787079 |
| Molecular Formula | C25H33N6Na2O6P |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | — |
| SMILES | Cc1nn(COP(=O)(O)O)c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)c2ccnn2C)C2CCCCC2)cc1.[Na].[Na] |
| InChI | InChI=1S/C25H33N6O6P.2Na/c1-16-22(17(2)31(29-16)15-37-38(34,35)36)18-9-11-20(12-10-18)27-25(33)23(19-7-5-4-6-8-19)28-24(32)21-13-14-26-30(21)3;;/h9-14,19,23H,4-8,15H2,1-3H3,(H,27,33)(H,28,32)(H2,34,35,36);;/t23-;;/m0../s1 |
| InChIKey | SAYUMTBHKIEWIQ-IFUPQEAVSA-N |
| XLogP | 2.52 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|