C59H79BBr2ClN8O5Si2 — CID 164952698
CID 164952698 (PubChem CID 164952698) has the molecular formula C59H79BBr2ClN8O5Si2 and a molecular weight of 1242.58 g/mol.
| Compound Name | CID 164952698 |
|---|---|
| PubChem CID | 164952698 |
| Molecular Formula | C59H79BBr2ClN8O5Si2 |
| Molecular Weight | 1242.58 g/mol |
| Exact Mass | 1239.39 |
| IUPAC Name | — |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](N)[C@@H]2CCCc3ccc(Br)cc32)cc1.Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](N[B]C=O)[C@@H]2CCCc3ccc(Br)cc32)cc1.Cl |
| InChI | InChI=1S/C30H39BBrN4O3Si.C29H39BrN4O2Si.ClH/c1-20-28(21(2)36(35-20)19-39-15-16-40(3,4)5)23-10-13-25(14-11-23)33-30(38)29(34-31-18-37)26-8-6-7-22-9-12-24(32)17-27(22)26;1-19-27(20(2)34(33-19)18-36-15-16-37(3,4)5)22-10-13-24(14-11-22)32-29(35)28(31)25-8-6-7-21-9-12-23(30)17-26(21)25;/h9-14,17-18,26,29,34H,6-8,15-16,19H2,1-5H3,(H,33,38);9-14,17,25,28H,6-8,15-16,18,31H2,1-5H3,(H,32,35);1H/t26-,29+;25-,28+;/m11./s1 |
| InChIKey | IWPDEWKFCFCTNY-PUUYOQEVSA-N |
| XLogP | 13.12 |
| TPSA | 167.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1242.58 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|