C34H38B2BrN3O7 — CID 165036574
CID 165036574 (PubChem CID 165036574) has the molecular formula C34H38B2BrN3O7 and a molecular weight of 702.22 g/mol.
| Compound Name | CID 165036574 |
|---|---|
| PubChem CID | 165036574 |
| Molecular Formula | C34H38B2BrN3O7 |
| Molecular Weight | 702.22 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | — |
| SMILES | CC(C)n1cc(-c2ccc3c(c2)[C@H]([C@H](N[B]C=O)C(=O)O)CCC3)ccc1=O.O=C[B]N[C@H](C(=O)O)[C@@H]1CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C21H24BN2O4.C13H14BBrNO3/c1-13(2)24-11-16(8-9-19(24)26)15-7-6-14-4-3-5-17(18(14)10-15)20(21(27)28)23-22-12-25;15-9-5-4-8-2-1-3-10(11(8)6-9)12(13(18)19)16-14-7-17/h6-13,17,20,23H,3-5H2,1-2H3,(H,27,28);4-7,10,12,16H,1-3H2,(H,18,19)/t17-,20+;10-,12+/m11/s1 |
| InChIKey | XYXMYVIMPVHHFO-OGAOENPCSA-N |
| XLogP | 4.09 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|