C40H51BN5O4Si — CID 164776149
CID 164776149 (PubChem CID 164776149) has the molecular formula C40H51BN5O4Si and a molecular weight of 704.78 g/mol.
| Compound Name | CID 164776149 |
|---|---|
| PubChem CID | 164776149 |
| Molecular Formula | C40H51BN5O4Si |
| Molecular Weight | 704.78 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | — |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](N[B]C=O)[C@@H]2CCc3ccc(-c4ccc(CN5CCOCC5)cc4)cc32)cc1 |
| InChI | InChI=1S/C40H51BN5O4Si/c1-28-38(29(2)46(44-28)27-50-22-23-51(3,4)5)33-12-15-35(16-13-33)42-40(48)39(43-41-26-47)36-17-14-32-10-11-34(24-37(32)36)31-8-6-30(7-9-31)25-45-18-20-49-21-19-45/h6-13,15-16,24,26,36,39,43H,14,17-23,25,27H2,1-5H3,(H,42,48)/t36-,39+/m1/s1 |
| InChIKey | NTQKUFFTPHUNGH-VWMWMKPNSA-N |
| XLogP | 6.41 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.78 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|