C30H31N5O3 — CID 163275835
N-[2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 163275835) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163275835 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-[2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-yl)ethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)C(NC(=O)c2ccnn2C)C2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C30H31N5O3/c1-19-16-18-35(38)20(2)27(19)22-11-13-23(14-12-22)32-30(37)28(33-29(36)26-15-17-31-34(26)3)25-10-6-8-21-7-4-5-9-24(21)25/h4-5,7,9,11-18,25,28H,6,8,10H2,1-3H3,(H,32,37)(H,33,36) |
| InChIKey | FWQDZOAPGRWDIL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|