C27H31F2N5O3 — CID 164514422
N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-2-fluoroanilino]-1-[(4S)-4-fluorocycloheptyl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 164514422) has the molecular formula C27H31F2N5O3 and a molecular weight of 511.57 g/mol. Its IUPAC name is N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-2-fluoroanilino]-1-[(4S)-4-fluorocycloheptyl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-2-fluoroanilino]-1-[(4S)-4-fluorocycloheptyl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 164514422 |
| Molecular Formula | C27H31F2N5O3 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | N-[(1S)-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)-2-fluoroanilino]-1-[(4S)-4-fluorocycloheptyl]-2-oxoethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)c2ccnn2C)C2CCC[C@H](F)CC2)c(F)c1 |
| InChI | InChI=1S/C27H31F2N5O3/c1-16-12-14-34(37)17(2)24(16)19-8-10-22(21(29)15-19)31-27(36)25(18-5-4-6-20(28)9-7-18)32-26(35)23-11-13-30-33(23)3/h8,10-15,18,20,25H,4-7,9H2,1-3H3,(H,31,36)(H,32,35)/t18?,20-,25-/m0/s1 |
| InChIKey | YTBYJRVLIASBGZ-ZGCXKRIGSA-N |
| XLogP | 4.13 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|