C26H40ClN5O2Si — CID 169015657
2-amino-3,3-dicyclopropyl-N-[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]prop-2-enamide;hydrochloride (PubChem CID 169015657) has the molecular formula C26H40ClN5O2Si and a molecular weight of 518.18 g/mol. Its IUPAC name is 2-amino-3,3-dicyclopropyl-N-[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]prop-2-enamide;hydrochloride.
| Compound Name | 2-amino-3,3-dicyclopropyl-N-[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 169015657 |
| Molecular Formula | C26H40ClN5O2Si |
| Molecular Weight | 518.18 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 2-amino-3,3-dicyclopropyl-N-[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]prop-2-enamide;hydrochloride |
| SMILES | CCc1c(-c2ccc(NC(=O)C(N)=C(C3CC3)C3CC3)cn2)c(C)nn1COCC[Si](C)(C)C.Cl |
| InChI | InChI=1S/C26H39N5O2Si.ClH/c1-6-22-23(17(2)30-31(22)16-33-13-14-34(3,4)5)21-12-11-20(15-28-21)29-26(32)25(27)24(18-7-8-18)19-9-10-19;/h11-12,15,18-19H,6-10,13-14,16,27H2,1-5H3,(H,29,32);1H |
| InChIKey | CTBCMUAXUSSYTG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.18 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|