C30H45Cl2N7O4Si — CID 167527698
N-[(2S)-6,6-dichloro-1-[[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-oxohexan-2-yl]-2-(2-methoxyethyl)pyrazole-3-carboxamide (PubChem CID 167527698) has the molecular formula C30H45Cl2N7O4Si and a molecular weight of 666.73 g/mol. Its IUPAC name is N-[(2S)-6,6-dichloro-1-[[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-oxohexan-2-yl]-2-(2-methoxyethyl)pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-6,6-dichloro-1-[[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-oxohexan-2-yl]-2-(2-methoxyethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167527698 |
| Molecular Formula | C30H45Cl2N7O4Si |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | N-[(2S)-6,6-dichloro-1-[[6-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-pyridinyl]amino]-1-oxohexan-2-yl]-2-(2-methoxyethyl)pyrazole-3-carboxamide |
| SMILES | CCc1c(-c2ccc(NC(=O)[C@H](CCCC(Cl)Cl)NC(=O)c3ccnn3CCOC)cn2)c(C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H45Cl2N7O4Si/c1-7-25-28(21(2)37-39(25)20-43-17-18-44(4,5)6)23-12-11-22(19-33-23)35-29(40)24(9-8-10-27(31)32)36-30(41)26-13-14-34-38(26)15-16-42-3/h11-14,19,24,27H,7-10,15-18,20H2,1-6H3,(H,35,40)(H,36,41)/t24-/m0/s1 |
| InChIKey | YGZJGYZVZKZSOI-DEOSSOPVSA-N |
| XLogP | 5.68 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|