C23H28Cl2FN7O3 — CID 167527331
N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-(3-hydroxypropyl)pyrazole-3-carboxamide (PubChem CID 167527331) has the molecular formula C23H28Cl2FN7O3 and a molecular weight of 540.43 g/mol. Its IUPAC name is N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-(3-hydroxypropyl)pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-(3-hydroxypropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167527331 |
| Molecular Formula | C23H28Cl2FN7O3 |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-(3-hydroxypropyl)pyrazole-3-carboxamide |
| SMILES | Cc1n[nH]c(C)c1-c1ccc(NC(=O)[C@H](CCCC(Cl)Cl)NC(=O)c2ccnn2CCCO)nc1F |
| InChI | InChI=1S/C23H28Cl2FN7O3/c1-13-20(14(2)32-31-13)15-7-8-19(29-21(15)26)30-22(35)16(5-3-6-18(24)25)28-23(36)17-9-10-27-33(17)11-4-12-34/h7-10,16,18,34H,3-6,11-12H2,1-2H3,(H,28,36)(H,31,32)(H,29,30,35)/t16-/m0/s1 |
| InChIKey | NTIUFHMMEUKFEM-INIZCTEOSA-N |
| XLogP | 3.52 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|