C22H25Cl2FN6O3 — CID 167527443
N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide (PubChem CID 167527443) has the molecular formula C22H25Cl2FN6O3 and a molecular weight of 511.39 g/mol. Its IUPAC name is N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167527443 |
| Molecular Formula | C22H25Cl2FN6O3 |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)N[C@@H](CCCC(Cl)Cl)C(=O)Nc1ccc(-c2c(C)noc2C)c(F)n1 |
| InChI | InChI=1S/C22H25Cl2FN6O3/c1-4-31-16(10-11-26-31)22(33)27-15(6-5-7-17(23)24)21(32)29-18-9-8-14(20(25)28-18)19-12(2)30-34-13(19)3/h8-11,15,17H,4-7H2,1-3H3,(H,27,33)(H,28,29,32)/t15-/m0/s1 |
| InChIKey | LMDQLCXBJDRNGL-HNNXBMFYSA-N |
| XLogP | 4.42 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|