C29H43Cl2N7O4Si — CID 167527644
N-[6,6-dichloro-1-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-methoxy-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide (PubChem CID 167527644) has the molecular formula C29H43Cl2N7O4Si and a molecular weight of 652.70 g/mol. Its IUPAC name is N-[6,6-dichloro-1-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-methoxy-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[6,6-dichloro-1-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-methoxy-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167527644 |
| Molecular Formula | C29H43Cl2N7O4Si |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 651.25 |
| IUPAC Name | N-[6,6-dichloro-1-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-methoxy-2-pyridinyl]amino]-1-oxohexan-2-yl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)NC(CCCC(Cl)Cl)C(=O)Nc1ccc(-c2c(C)nn(COCC[Si](C)(C)C)c2C)c(OC)n1 |
| InChI | InChI=1S/C29H43Cl2N7O4Si/c1-8-37-23(14-15-32-37)28(40)33-22(10-9-11-24(30)31)27(39)34-25-13-12-21(29(35-25)41-4)26-19(2)36-38(20(26)3)18-42-16-17-43(5,6)7/h12-15,22,24H,8-11,16-18H2,1-7H3,(H,33,40)(H,34,35,39) |
| InChIKey | IYVCEBSTRSWPKM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|