C31H43FN6O4Si — CID 168868994
N-[(2S)-1,1-dicyclopropyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-3-ethyl-1,2-oxazole-4-carboxamide (PubChem CID 168868994) has the molecular formula C31H43FN6O4Si and a molecular weight of 610.81 g/mol. Its IUPAC name is N-[(2S)-1,1-dicyclopropyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-3-ethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(2S)-1,1-dicyclopropyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-3-ethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 168868994 |
| Molecular Formula | C31H43FN6O4Si |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | N-[(2S)-1,1-dicyclopropyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-3-ethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1nocc1C(=O)N[C@H](C(=O)Nc1ccc(-c2c(C)nn(COCC[Si](C)(C)C)c2C)c(F)n1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C31H43FN6O4Si/c1-7-24-23(16-42-37-24)30(39)35-28(27(20-8-9-20)21-10-11-21)31(40)34-25-13-12-22(29(32)33-25)26-18(2)36-38(19(26)3)17-41-14-15-43(4,5)6/h12-13,16,20-21,27-28H,7-11,14-15,17H2,1-6H3,(H,35,39)(H,33,34,40)/t28-/m0/s1 |
| InChIKey | FOTBLWLVCZGHNB-NDEPHWFRSA-N |
| XLogP | 5.74 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|