C36H57F2N5O4Si — CID 175433152
tert-butyl N-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,6-difluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]carbamate (PubChem CID 175433152) has the molecular formula C36H57F2N5O4Si and a molecular weight of 689.97 g/mol. Its IUPAC name is tert-butyl N-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,6-difluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,6-difluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175433152 |
| Molecular Formula | C36H57F2N5O4Si |
| Molecular Weight | 689.97 g/mol |
| Exact Mass | 689.41 |
| IUPAC Name | tert-butyl N-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,6-difluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]carbamate |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1c(F)cc(NC(=O)C(NC(=O)OC(C)(C)C)C(C2CCCCC2)C2CCCCC2)nc1F |
| InChI | InChI=1S/C36H57F2N5O4Si/c1-23-29(24(2)43(42-23)22-46-19-20-48(6,7)8)31-27(37)21-28(39-33(31)38)40-34(44)32(41-35(45)47-36(3,4)5)30(25-15-11-9-12-16-25)26-17-13-10-14-18-26/h21,25-26,30,32H,9-20,22H2,1-8H3,(H,41,45)(H,39,40,44) |
| InChIKey | NKPNWGTYSVFNDG-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.97 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|