C38H58FN7O3Si — CID 175433422
4-[1,1-dicyclohexyl-3-[[5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-ethylpyrazole-5-carboxamide (PubChem CID 175433422) has the molecular formula C38H58FN7O3Si and a molecular weight of 708.01 g/mol. Its IUPAC name is 4-[1,1-dicyclohexyl-3-[[5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-[1,1-dicyclohexyl-3-[[5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175433422 |
| Molecular Formula | C38H58FN7O3Si |
| Molecular Weight | 708.01 g/mol |
| Exact Mass | 707.44 |
| IUPAC Name | 4-[1,1-dicyclohexyl-3-[[5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-ethylpyrazole-5-carboxamide |
| SMILES | CCc1c(-c2ccc(NC(=O)C(c3cnn(CC)c3C(N)=O)C(C3CCCCC3)C3CCCCC3)nc2F)c(C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C38H58FN7O3Si/c1-7-30-32(25(3)44-46(30)24-49-21-22-50(4,5)6)28-19-20-31(42-36(28)39)43-38(48)34(29-23-41-45(8-2)35(29)37(40)47)33(26-15-11-9-12-16-26)27-17-13-10-14-18-27/h19-20,23,26-27,33-34H,7-18,21-22,24H2,1-6H3,(H2,40,47)(H,42,43,48) |
| InChIKey | JPHPNSOEQYETQQ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.01 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|