C31H51FN6O2Si — CID 175433325
2-amino-N-[4-amino-5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]-3,3-dicyclohexylpropanamide (PubChem CID 175433325) has the molecular formula C31H51FN6O2Si and a molecular weight of 586.87 g/mol. Its IUPAC name is 2-amino-N-[4-amino-5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]-3,3-dicyclohexylpropanamide.
| Compound Name | 2-amino-N-[4-amino-5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]-3,3-dicyclohexylpropanamide |
|---|---|
| PubChem CID | 175433325 |
| Molecular Formula | C31H51FN6O2Si |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.38 |
| IUPAC Name | 2-amino-N-[4-amino-5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]-3,3-dicyclohexylpropanamide |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1c(N)cc(NC(=O)C(N)C(C2CCCCC2)C2CCCCC2)nc1F |
| InChI | InChI=1S/C31H51FN6O2Si/c1-20-26(21(2)38(37-20)19-40-16-17-41(3,4)5)28-24(33)18-25(35-30(28)32)36-31(39)29(34)27(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h18,22-23,27,29H,6-17,19,34H2,1-5H3,(H3,33,35,36,39) |
| InChIKey | JUQUNLUDYHFYPE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|