C36H54FN7O3Si — CID 175433296
4-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide (PubChem CID 175433296) has the molecular formula C36H54FN7O3Si and a molecular weight of 679.96 g/mol. Its IUPAC name is 4-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175433296 |
| Molecular Formula | C36H54FN7O3Si |
| Molecular Weight | 679.96 g/mol |
| Exact Mass | 679.40 |
| IUPAC Name | 4-[1,1-dicyclohexyl-3-[[5-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-6-fluoro-2-pyridinyl]amino]-3-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)C(c2cnn(C)c2C(N)=O)C(C2CCCCC2)C2CCCCC2)nc1F |
| InChI | InChI=1S/C36H54FN7O3Si/c1-23-30(24(2)44(42-23)22-47-19-20-48(4,5)6)27-17-18-29(40-34(27)37)41-36(46)32(28-21-39-43(3)33(28)35(38)45)31(25-13-9-7-10-14-25)26-15-11-8-12-16-26/h17-18,21,25-26,31-32H,7-16,19-20,22H2,1-6H3,(H2,38,45)(H,40,41,46) |
| InChIKey | PIWZVBZTTBVZDU-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.96 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|