C20H22Cl2FN7O3 — CID 167527330
N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-4-methyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 167527330) has the molecular formula C20H22Cl2FN7O3 and a molecular weight of 498.35 g/mol. Its IUPAC name is N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-4-methyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 167527330 |
| Molecular Formula | C20H22Cl2FN7O3 |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-[(2S)-6,6-dichloro-1-[[5-(3,5-dimethyl-1H-pyrazol-4-yl)-6-fluoro-2-pyridinyl]amino]-1-oxohexan-2-yl]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1nonc1C(=O)N[C@@H](CCCC(Cl)Cl)C(=O)Nc1ccc(-c2c(C)n[nH]c2C)c(F)n1 |
| InChI | InChI=1S/C20H22Cl2FN7O3/c1-9-16(10(2)28-27-9)12-7-8-15(25-18(12)23)26-19(31)13(5-4-6-14(21)22)24-20(32)17-11(3)29-33-30-17/h7-8,13-14H,4-6H2,1-3H3,(H,24,32)(H,27,28)(H,25,26,31)/t13-/m0/s1 |
| InChIKey | MGGUEKRYWHKSBX-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|