C22H33Cl2N5O3Si — CID 167527308
(4S)-4-amino-5,5-dichloro-N-[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5-hydroxy-3-pyridinyl]-2-methylidenepentanamide (PubChem CID 167527308) has the molecular formula C22H33Cl2N5O3Si and a molecular weight of 514.53 g/mol. Its IUPAC name is (4S)-4-amino-5,5-dichloro-N-[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5-hydroxy-3-pyridinyl]-2-methylidenepentanamide.
| Compound Name | (4S)-4-amino-5,5-dichloro-N-[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5-hydroxy-3-pyridinyl]-2-methylidenepentanamide |
|---|---|
| PubChem CID | 167527308 |
| Molecular Formula | C22H33Cl2N5O3Si |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | (4S)-4-amino-5,5-dichloro-N-[6-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-5-hydroxy-3-pyridinyl]-2-methylidenepentanamide |
| SMILES | C=C(C[C@H](N)C(Cl)Cl)C(=O)Nc1cnc(-c2c(C)nn(COCC[Si](C)(C)C)c2C)c(O)c1 |
| InChI | InChI=1S/C22H33Cl2N5O3Si/c1-13(9-17(25)21(23)24)22(31)27-16-10-18(30)20(26-11-16)19-14(2)28-29(15(19)3)12-32-7-8-33(4,5)6/h10-11,17,21,30H,1,7-9,12,25H2,2-6H3,(H,27,31)/t17-/m0/s1 |
| InChIKey | HSDZMTIOOCMJCH-KRWDZBQOSA-N |
| XLogP | 4.60 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|