C15H23N3O3Si — CID 170590267
methyl 5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridine-3-carboxylate (PubChem CID 170590267) has the molecular formula C15H23N3O3Si and a molecular weight of 321.45 g/mol. Its IUPAC name is methyl 5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridine-3-carboxylate.
| Compound Name | methyl 5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170590267 |
| Molecular Formula | C15H23N3O3Si |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | methyl 5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1nn(COCC[Si](C)(C)C)c2cnc(C)cc12 |
| InChI | InChI=1S/C15H23N3O3Si/c1-11-8-12-13(9-16-11)18(17-14(12)15(19)20-2)10-21-6-7-22(3,4)5/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | XZBVQRRBCRTBAJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|