C35H44N8O6Si — CID 159062538
methyl 5-[1-(2-hydroxyethyl)pyrazol-4-yl]-1H-indazole-3-carboxylate;methyl 5-(1-propylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate (PubChem CID 159062538) has the molecular formula C35H44N8O6Si and a molecular weight of 700.87 g/mol. Its IUPAC name is methyl 5-[1-(2-hydroxyethyl)pyrazol-4-yl]-1H-indazole-3-carboxylate;methyl 5-(1-propylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate.
| Compound Name | methyl 5-[1-(2-hydroxyethyl)pyrazol-4-yl]-1H-indazole-3-carboxylate;methyl 5-(1-propylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 159062538 |
| Molecular Formula | C35H44N8O6Si |
| Molecular Weight | 700.87 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | methyl 5-[1-(2-hydroxyethyl)pyrazol-4-yl]-1H-indazole-3-carboxylate;methyl 5-(1-propylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylate |
| SMILES | CCCn1cc(-c2ccc3c(c2)c(C(=O)OC)nn3COCC[Si](C)(C)C)cn1.COC(=O)c1n[nH]c2ccc(-c3cnn(CCO)c3)cc12 |
| InChI | InChI=1S/C21H30N4O3Si.C14H14N4O3/c1-6-9-24-14-17(13-22-24)16-7-8-19-18(12-16)20(21(26)27-2)23-25(19)15-28-10-11-29(3,4)5;1-21-14(20)13-11-6-9(2-3-12(11)16-17-13)10-7-15-18(8-10)4-5-19/h7-8,12-14H,6,9-11,15H2,1-5H3;2-3,6-8,19H,4-5H2,1H3,(H,16,17) |
| InChIKey | JYQNEPZUMIPWHE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 164.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|