C20H26N4O3Si — CID 162527237
methyl 5-(3-aminophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxylate (PubChem CID 162527237) has the molecular formula C20H26N4O3Si and a molecular weight of 398.54 g/mol. Its IUPAC name is methyl 5-(3-aminophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxylate.
| Compound Name | methyl 5-(3-aminophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 162527237 |
| Molecular Formula | C20H26N4O3Si |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl 5-(3-aminophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1nn(COCC[Si](C)(C)C)c2cnc(-c3cccc(N)c3)cc12 |
| InChI | InChI=1S/C20H26N4O3Si/c1-26-20(25)19-16-11-17(14-6-5-7-15(21)10-14)22-12-18(16)24(23-19)13-27-8-9-28(2,3)4/h5-7,10-12H,8-9,13,21H2,1-4H3 |
| InChIKey | XIUANWXFCZRJGP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|