C28H37ClN6O3Si — CID 162527738
5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(1-methylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide (PubChem CID 162527738) has the molecular formula C28H37ClN6O3Si and a molecular weight of 569.18 g/mol. Its IUPAC name is 5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(1-methylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide.
| Compound Name | 5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(1-methylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162527738 |
| Molecular Formula | C28H37ClN6O3Si |
| Molecular Weight | 569.18 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(1-methylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridine-3-carboxamide |
| SMILES | C=CC(=O)Nc1cc(Cl)cc(-c2cc3c(C(=O)NC4CCN(C)CC4)nn(COCC[Si](C)(C)C)c3cn2)c1 |
| InChI | InChI=1S/C28H37ClN6O3Si/c1-6-26(36)31-22-14-19(13-20(29)15-22)24-16-23-25(17-30-24)35(18-38-11-12-39(3,4)5)33-27(23)28(37)32-21-7-9-34(2)10-8-21/h6,13-17,21H,1,7-12,18H2,2-5H3,(H,31,36)(H,32,37) |
| InChIKey | AKLPYIMOOXLIGB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|