C20H25ClN4O2Si — CID 175820295
2-[5-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-N-methylbenzamide (PubChem CID 175820295) has the molecular formula C20H25ClN4O2Si and a molecular weight of 416.99 g/mol. Its IUPAC name is 2-[5-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-N-methylbenzamide.
| Compound Name | 2-[5-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 175820295 |
| Molecular Formula | C20H25ClN4O2Si |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[5-chloro-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-3-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1-c1nn(COCC[Si](C)(C)C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C20H25ClN4O2Si/c1-22-20(26)15-8-6-5-7-14(15)19-16-11-18(21)23-12-17(16)25(24-19)13-27-9-10-28(2,3)4/h5-8,11-12H,9-10,13H2,1-4H3,(H,22,26) |
| InChIKey | SQXBJQYUPPRNLL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|