C26H31ClN4O2Si — CID 156674730
2-[[3-(6-chloro-3-pyridinyl)-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 156674730) has the molecular formula C26H31ClN4O2Si and a molecular weight of 495.10 g/mol. Its IUPAC name is 2-[[3-(6-chloro-3-pyridinyl)-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(6-chloro-3-pyridinyl)-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 156674730 |
| Molecular Formula | C26H31ClN4O2Si |
| Molecular Weight | 495.10 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 2-[[3-(6-chloro-3-pyridinyl)-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2c(nc1-c1cccc(C)c1C)c(-c1ccc(Cl)nc1)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H31ClN4O2Si/c1-17-8-7-9-20(18(17)2)25-22(32-3)14-21-26(29-25)24(19-10-11-23(27)28-15-19)30-31(21)16-33-12-13-34(4,5)6/h7-11,14-15H,12-13,16H2,1-6H3 |
| InChIKey | NORXIHVLVNAKPI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.10 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|