C15H21ClN6OSi — CID 140850912
2-[[5-chloro-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140850912) has the molecular formula C15H21ClN6OSi and a molecular weight of 364.91 g/mol. Its IUPAC name is 2-[[5-chloro-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-chloro-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140850912 |
| Molecular Formula | C15H21ClN6OSi |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[[5-chloro-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cn1cc(-c2nn(COCC[Si](C)(C)C)c3cnc(Cl)nc23)cn1 |
| InChI | InChI=1S/C15H21ClN6OSi/c1-21-9-11(7-18-21)13-14-12(8-17-15(16)19-14)22(20-13)10-23-5-6-24(2,3)4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | RABYPHUPFIPZKZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|