C16H19ClN4O2Si — CID 140850910
4-[5-chloro-1-(2-trimethylsilylethoxy)pyrazolo[4,3-d]pyrimidin-3-yl]phenol (PubChem CID 140850910) has the molecular formula C16H19ClN4O2Si and a molecular weight of 362.89 g/mol. Its IUPAC name is 4-[5-chloro-1-(2-trimethylsilylethoxy)pyrazolo[4,3-d]pyrimidin-3-yl]phenol.
| Compound Name | 4-[5-chloro-1-(2-trimethylsilylethoxy)pyrazolo[4,3-d]pyrimidin-3-yl]phenol |
|---|---|
| PubChem CID | 140850910 |
| Molecular Formula | C16H19ClN4O2Si |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-[5-chloro-1-(2-trimethylsilylethoxy)pyrazolo[4,3-d]pyrimidin-3-yl]phenol |
| SMILES | C[Si](C)(C)CCOn1nc(-c2ccc(O)cc2)c2nc(Cl)ncc21 |
| InChI | InChI=1S/C16H19ClN4O2Si/c1-24(2,3)9-8-23-21-13-10-18-16(17)19-15(13)14(20-21)11-4-6-12(22)7-5-11/h4-7,10,22H,8-9H2,1-3H3 |
| InChIKey | GUTKQBPIEXDVET-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|