C17H25N3O2Si — CID 153483568
4-[5-cyclopropyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenol (PubChem CID 153483568) has the molecular formula C17H25N3O2Si and a molecular weight of 331.49 g/mol. Its IUPAC name is 4-[5-cyclopropyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenol.
| Compound Name | 4-[5-cyclopropyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 153483568 |
| Molecular Formula | C17H25N3O2Si |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-[5-cyclopropyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenol |
| SMILES | C[Si](C)(C)CCOCn1nc(C2CC2)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C17H25N3O2Si/c1-23(2,3)11-10-22-12-20-17(14-6-8-15(21)9-7-14)18-16(19-20)13-4-5-13/h6-9,13,21H,4-5,10-12H2,1-3H3 |
| InChIKey | GTXQNEWODMRRGG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|